C17H14F3NO4 — CID 7485742
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-methoxybenzoate (PubChem CID 7485742) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-methoxybenzoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 7485742 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO4/c1-24-14-5-3-2-4-13(14)16(23)25-10-15(22)21-12-8-6-11(7-9-12)17(18,19)20/h2-9H,10H2,1H3,(H,21,22) |
| InChIKey | QYZLITAENNSIMR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |