C17H15N3O6S — CID 27066025
[2-(4-nitroanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate (PubChem CID 27066025) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 27066025 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
| SMILES | NC(=O)CSc1ccccc1C(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15N3O6S/c18-15(21)10-27-14-4-2-1-3-13(14)17(23)26-9-16(22)19-11-5-7-12(8-6-11)20(24)25/h1-8H,9-10H2,(H2,18,21)(H,19,22) |
| InChIKey | NESRBRORLOWRON-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|