C15H12ClFN2O5S — CID 8620088
[2-oxo-2-(3-sulfamoylanilino)ethyl] 5-chloro-2-fluorobenzoate (PubChem CID 8620088) has the molecular formula C15H12ClFN2O5S and a molecular weight of 386.79 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 5-chloro-2-fluorobenzoate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8620088 |
| Molecular Formula | C15H12ClFN2O5S |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 5-chloro-2-fluorobenzoate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)c2cc(Cl)ccc2F)c1 |
| InChI | InChI=1S/C15H12ClFN2O5S/c16-9-4-5-13(17)12(6-9)15(21)24-8-14(20)19-10-2-1-3-11(7-10)25(18,22)23/h1-7H,8H2,(H,19,20)(H2,18,22,23) |
| InChIKey | YRQDHTCQWPGFDB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |