C14H12Cl2N2O4S — CID 9413124
2-(2,4-dichlorophenoxy)-N-(3-sulfamoylphenyl)acetamide (PubChem CID 9413124) has the molecular formula C14H12Cl2N2O4S and a molecular weight of 375.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 9413124 |
| Molecular Formula | C14H12Cl2N2O4S |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(3-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H12Cl2N2O4S/c15-9-4-5-13(12(16)6-9)22-8-14(19)18-10-2-1-3-11(7-10)23(17,20)21/h1-7H,8H2,(H,18,19)(H2,17,20,21) |
| InChIKey | PEZUSABTFWYZKH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |