C15H10ClF2NO3 — CID 46925028
[2-(3-chloroanilino)-2-oxoethyl] 2,5-difluorobenzoate (PubChem CID 46925028) has the molecular formula C15H10ClF2NO3 and a molecular weight of 325.70 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 2,5-difluorobenzoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 2,5-difluorobenzoate |
|---|---|
| PubChem CID | 46925028 |
| Molecular Formula | C15H10ClF2NO3 |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 2,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)ccc1F)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H10ClF2NO3/c16-9-2-1-3-11(6-9)19-14(20)8-22-15(21)12-7-10(17)4-5-13(12)18/h1-7H,8H2,(H,19,20) |
| InChIKey | FNINVSBXKZQVSR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |