C17H16BrFN2O5S — CID 26178371
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 5-bromo-2-fluorobenzoate (PubChem CID 26178371) has the molecular formula C17H16BrFN2O5S and a molecular weight of 459.29 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 5-bromo-2-fluorobenzoate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 5-bromo-2-fluorobenzoate |
|---|---|
| PubChem CID | 26178371 |
| Molecular Formula | C17H16BrFN2O5S |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 5-bromo-2-fluorobenzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COC(=O)c2cc(Br)ccc2F)c1 |
| InChI | InChI=1S/C17H16BrFN2O5S/c1-21(2)27(24,25)13-5-3-4-12(9-13)20-16(22)10-26-17(23)14-8-11(18)6-7-15(14)19/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | JEGKOUIDOMKJHN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |