About [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate
[2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate (PubChem CID 8803664) has the molecular formula C19H13BrFNO3
and a molecular weight of 402.22 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate |
| PubChem CID | 8803664 |
| Molecular Formula | C19H13BrFNO3 |
| Molecular Weight | 402.22 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)ccc1F)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H13BrFNO3/c20-14-6-8-17(21)16(10-14)19(24)25-11-18(23)22-15-7-5-12-3-1-2-4-13(12)9-15/h1-10H,11H2,(H,22,23) |
| InChIKey | OASFBNXOVYSHAZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate?
The IUPAC name of [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate (CID 8803664) is [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate.
What is the SMILES notation for [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate?
The canonical SMILES for [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate is O=C(COC(=O)c1cc(Br)ccc1F)Nc1ccc2ccccc2c1.
What is the InChIKey of [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate?
The InChIKey is OASFBNXOVYSHAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrFNO3/c20-14-6-8-17(21)16(10-14)19(24)25-11-18(23)22-15-7-5-12-3-1-2-4-13(12)9-15/h1-10H,11H2,(H,22,23).
What are the key properties of [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate?
[2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate has a molecular weight of 402.22 g/mol, XLogP of 4.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(naphthalen-2-ylamino)-2-oxoethyl] 5-bromo-2-fluorobenzoate is sourced from PubChem (CID 8803664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).