C26H20FNO4 — CID 2116978
[2-(naphthalen-2-ylamino)-2-oxoethyl] 2-[(4-fluorophenyl)methoxy]benzoate (PubChem CID 2116978) has the molecular formula C26H20FNO4 and a molecular weight of 429.45 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-[(4-fluorophenyl)methoxy]benzoate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-[(4-fluorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 2116978 |
| Molecular Formula | C26H20FNO4 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 2-[(4-fluorophenyl)methoxy]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1OCc1ccc(F)cc1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H20FNO4/c27-21-12-9-18(10-13-21)16-31-24-8-4-3-7-23(24)26(30)32-17-25(29)28-22-14-11-19-5-1-2-6-20(19)15-22/h1-15H,16-17H2,(H,28,29) |
| InChIKey | SGUIZABFCWMZRT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |