C21H18FNO3 — CID 8551549
[2-(naphthalen-2-ylamino)-2-oxoethyl] 3-(4-fluorophenyl)propanoate (PubChem CID 8551549) has the molecular formula C21H18FNO3 and a molecular weight of 351.38 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 3-(4-fluorophenyl)propanoate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 8551549 |
| Molecular Formula | C21H18FNO3 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 3-(4-fluorophenyl)propanoate |
| SMILES | O=C(COC(=O)CCc1ccc(F)cc1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18FNO3/c22-18-9-5-15(6-10-18)7-12-21(25)26-14-20(24)23-19-11-8-16-3-1-2-4-17(16)13-19/h1-6,8-11,13H,7,12,14H2,(H,23,24) |
| InChIKey | AXTAGTAOLBLZTL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |