C22H16F3NO4 — CID 2605864
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-phenylmethoxybenzoate (PubChem CID 2605864) has the molecular formula C22H16F3NO4 and a molecular weight of 415.37 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-phenylmethoxybenzoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 2605864 |
| Molecular Formula | C22H16F3NO4 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 2-phenylmethoxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1OCc1ccccc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H16F3NO4/c23-16-10-11-17(21(25)20(16)24)26-19(27)13-30-22(28)15-8-4-5-9-18(15)29-12-14-6-2-1-3-7-14/h1-11H,12-13H2,(H,26,27) |
| InChIKey | FVCSGCCGAKAGOO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|