C20H14F3NO4 — CID 7376958
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-methoxynaphthalene-2-carboxylate (PubChem CID 7376958) has the molecular formula C20H14F3NO4 and a molecular weight of 389.33 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-methoxynaphthalene-2-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-methoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7376958 |
| Molecular Formula | C20H14F3NO4 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-methoxynaphthalene-2-carboxylate |
| SMILES | COc1cc2ccccc2cc1C(=O)OCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H14F3NO4/c1-27-16-9-12-5-3-2-4-11(12)8-13(16)20(26)28-10-17(25)24-15-7-6-14(21)18(22)19(15)23/h2-9H,10H2,1H3,(H,24,25) |
| InChIKey | GZYNWPJKBJIZGQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|