C17H14F3NO5 — CID 2349931
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3,4-dimethoxybenzoate (PubChem CID 2349931) has the molecular formula C17H14F3NO5 and a molecular weight of 369.30 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 2349931 |
| Molecular Formula | C17H14F3NO5 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C17H14F3NO5/c1-24-12-6-3-9(7-13(12)25-2)17(23)26-8-14(22)21-11-5-4-10(18)15(19)16(11)20/h3-7H,8H2,1-2H3,(H,21,22) |
| InChIKey | UXHNECCQJXQBIW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|