C16H11F4NO4 — CID 7991426
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-fluoro-4-methoxybenzoate (PubChem CID 7991426) has the molecular formula C16H11F4NO4 and a molecular weight of 357.26 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-fluoro-4-methoxybenzoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 7991426 |
| Molecular Formula | C16H11F4NO4 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(F)c(F)c2F)cc1F |
| InChI | InChI=1S/C16H11F4NO4/c1-24-12-5-2-8(6-10(12)18)16(23)25-7-13(22)21-11-4-3-9(17)14(19)15(11)20/h2-6H,7H2,1H3,(H,21,22) |
| InChIKey | OVQJJXMDKADGPP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|