C17H15F2NO5 — CID 2592169
[2-(2,6-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate (PubChem CID 2592169) has the molecular formula C17H15F2NO5 and a molecular weight of 351.31 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 2592169 |
| Molecular Formula | C17H15F2NO5 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2c(F)cccc2F)cc1OC |
| InChI | InChI=1S/C17H15F2NO5/c1-23-13-7-6-10(8-14(13)24-2)17(22)25-9-15(21)20-16-11(18)4-3-5-12(16)19/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | PQUHNIPSUYIWPK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |