C18H17F2NO5 — CID 2396240
[2-(2,6-difluoroanilino)-2-oxoethyl] 3,5-dimethoxy-4-methylbenzoate (PubChem CID 2396240) has the molecular formula C18H17F2NO5 and a molecular weight of 365.33 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 3,5-dimethoxy-4-methylbenzoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3,5-dimethoxy-4-methylbenzoate |
|---|---|
| PubChem CID | 2396240 |
| Molecular Formula | C18H17F2NO5 |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3,5-dimethoxy-4-methylbenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2c(F)cccc2F)cc(OC)c1C |
| InChI | InChI=1S/C18H17F2NO5/c1-10-14(24-2)7-11(8-15(10)25-3)18(23)26-9-16(22)21-17-12(19)5-4-6-13(17)20/h4-8H,9H2,1-3H3,(H,21,22) |
| InChIKey | RQMXRLVWDWFOFF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |