C18H18FNO3 — CID 9386525
[2-(2,6-dimethylanilino)-2-oxoethyl] 3-fluoro-4-methylbenzoate (PubChem CID 9386525) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] 3-fluoro-4-methylbenzoate.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 3-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 9386525 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 3-fluoro-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2c(C)cccc2C)cc1F |
| InChI | InChI=1S/C18H18FNO3/c1-11-7-8-14(9-15(11)19)18(22)23-10-16(21)20-17-12(2)5-4-6-13(17)3/h4-9H,10H2,1-3H3,(H,20,21) |
| InChIKey | BXFIGXDYRYEIRP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |