About [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate (PubChem CID 46860713) has the molecular formula C18H16FNO4
and a molecular weight of 329.33 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate.
Molecular Properties
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate |
| PubChem CID | 46860713 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate |
| SMILES | CC(=O)c1cccc(C(=O)OCC(=O)Nc2ccc(C)c(F)c2)c1 |
| InChI | InChI=1S/C18H16FNO4/c1-11-6-7-15(9-16(11)19)20-17(22)10-24-18(23)14-5-3-4-13(8-14)12(2)21/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | YEJSXDVPFOHXNF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate?
The IUPAC name of [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate (CID 46860713) is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate.
What is the SMILES notation for [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate?
The canonical SMILES for [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate is CC(=O)c1cccc(C(=O)OCC(=O)Nc2ccc(C)c(F)c2)c1.
What is the InChIKey of [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate?
The InChIKey is YEJSXDVPFOHXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FNO4/c1-11-6-7-15(9-16(11)19)20-17(22)10-24-18(23)14-5-3-4-13(8-14)12(2)21/h3-9H,10H2,1-2H3,(H,20,22).
What are the key properties of [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate?
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate has a molecular weight of 329.33 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 3-acetylbenzoate is sourced from PubChem (CID 46860713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).