About [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate
[2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate (PubChem CID 2427007) has the molecular formula C17H14FNO4
and a molecular weight of 315.30 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate |
| PubChem CID | 2427007 |
| Molecular Formula | C17H14FNO4 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H14FNO4/c1-11(20)12-5-7-15(8-6-12)19-16(21)10-23-17(22)13-3-2-4-14(18)9-13/h2-9H,10H2,1H3,(H,19,21) |
| InChIKey | AFENJMCNJNVACT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate?
The IUPAC name of [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate (CID 2427007) is [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate.
What is the SMILES notation for [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate?
The canonical SMILES for [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate is CC(=O)c1ccc(NC(=O)COC(=O)c2cccc(F)c2)cc1.
What is the InChIKey of [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate?
The InChIKey is AFENJMCNJNVACT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14FNO4/c1-11(20)12-5-7-15(8-6-12)19-16(21)10-23-17(22)13-3-2-4-14(18)9-13/h2-9H,10H2,1H3,(H,19,21).
What are the key properties of [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate?
[2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate has a molecular weight of 315.30 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-acetylanilino)-2-oxoethyl] 3-fluorobenzoate is sourced from PubChem (CID 2427007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).