C15H11F2NO4 — CID 2628769
[2-(2,6-difluoroanilino)-2-oxoethyl] 3-hydroxybenzoate (PubChem CID 2628769) has the molecular formula C15H11F2NO4 and a molecular weight of 307.25 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 3-hydroxybenzoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 2628769 |
| Molecular Formula | C15H11F2NO4 |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cccc(O)c1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H11F2NO4/c16-11-5-2-6-12(17)14(11)18-13(20)8-22-15(21)9-3-1-4-10(19)7-9/h1-7,19H,8H2,(H,18,20) |
| InChIKey | SEYMQIXWRXFCPK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |