C15H9F4NO3 — CID 2555034
[2-(2,6-difluoroanilino)-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 2555034) has the molecular formula C15H9F4NO3 and a molecular weight of 327.23 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 2555034 |
| Molecular Formula | C15H9F4NO3 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1F)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H9F4NO3/c16-8-4-5-9(12(19)6-8)15(22)23-7-13(21)20-14-10(17)2-1-3-11(14)18/h1-6H,7H2,(H,20,21) |
| InChIKey | KEDFHVGYEDVDIZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |