C16H13F2NO3 — CID 2338039
[2-(benzylamino)-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 2338039) has the molecular formula C16H13F2NO3 and a molecular weight of 305.28 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 2338039 |
| Molecular Formula | C16H13F2NO3 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1F)NCc1ccccc1 |
| InChI | InChI=1S/C16H13F2NO3/c17-12-6-7-13(14(18)8-12)16(21)22-10-15(20)19-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,19,20) |
| InChIKey | QCEDGSCPUGKSIL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |