C23H19F2NO3 — CID 23988753
[2-(dibenzylamino)-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 23988753) has the molecular formula C23H19F2NO3 and a molecular weight of 395.41 g/mol. Its IUPAC name is [2-(dibenzylamino)-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-(dibenzylamino)-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 23988753 |
| Molecular Formula | C23H19F2NO3 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [2-(dibenzylamino)-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | O=C(OCC(=O)N(Cc1ccccc1)Cc1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H19F2NO3/c24-19-11-12-20(21(25)13-19)23(28)29-16-22(27)26(14-17-7-3-1-4-8-17)15-18-9-5-2-6-10-18/h1-13H,14-16H2 |
| InChIKey | JVXOYTFVLKOCIW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |