C19H17F2N3O2 — CID 55864480
N-[3-[benzyl(cyanomethyl)amino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 55864480) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is N-[3-[benzyl(cyanomethyl)amino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[benzyl(cyanomethyl)amino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 55864480 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[3-[benzyl(cyanomethyl)amino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | N#CCN(Cc1ccccc1)C(=O)CCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H17F2N3O2/c20-15-6-7-16(17(21)12-15)19(26)23-10-8-18(25)24(11-9-22)13-14-4-2-1-3-5-14/h1-7,12H,8,10-11,13H2,(H,23,26) |
| InChIKey | BVOVDIPRLMRIEP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|