C19H19F3N2O2 — CID 51192745
2,4-difluoro-N-[4-[(4-fluorophenyl)methyl-methylamino]-4-oxobutyl]benzamide (PubChem CID 51192745) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-[(4-fluorophenyl)methyl-methylamino]-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-[(4-fluorophenyl)methyl-methylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 51192745 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2,4-difluoro-N-[4-[(4-fluorophenyl)methyl-methylamino]-4-oxobutyl]benzamide |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)CCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H19F3N2O2/c1-24(12-13-4-6-14(20)7-5-13)18(25)3-2-10-23-19(26)16-9-8-15(21)11-17(16)22/h4-9,11H,2-3,10,12H2,1H3,(H,23,26) |
| InChIKey | WNUSNWDCYCKZRB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|