C23H28F2N2O4 — CID 24655942
N-[4-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 24655942) has the molecular formula C23H28F2N2O4 and a molecular weight of 434.48 g/mol. Its IUPAC name is N-[4-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 24655942 |
| Molecular Formula | C23H28F2N2O4 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[4-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | CCOc1ccc(CN(CC)C(=O)CCCNC(=O)c2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C23H28F2N2O4/c1-4-27(15-16-8-11-20(31-5-2)21(13-16)30-3)22(28)7-6-12-26-23(29)18-10-9-17(24)14-19(18)25/h8-11,13-14H,4-7,12,15H2,1-3H3,(H,26,29) |
| InChIKey | PIRWAIIPPHOBJZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|