C20H19F5N2O3 — CID 37492052
2,4-difluoro-N-[4-[methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]-4-oxobutyl]benzamide (PubChem CID 37492052) has the molecular formula C20H19F5N2O3 and a molecular weight of 430.37 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-[methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-[methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 37492052 |
| Molecular Formula | C20H19F5N2O3 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2,4-difluoro-N-[4-[methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]-4-oxobutyl]benzamide |
| SMILES | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)CCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H19F5N2O3/c1-27(12-13-4-7-15(8-5-13)30-20(23,24)25)18(28)3-2-10-26-19(29)16-9-6-14(21)11-17(16)22/h4-9,11H,2-3,10,12H2,1H3,(H,26,29) |
| InChIKey | LMSWKNHUSVLGGJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|