C21H23F2N3O3 — CID 29481344
2,4-difluoro-N-[2-[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]-2-oxoethyl]benzamide (PubChem CID 29481344) has the molecular formula C21H23F2N3O3 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 29481344 |
| Molecular Formula | C21H23F2N3O3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2,4-difluoro-N-[2-[methyl-[(4-morpholin-4-ylphenyl)methyl]amino]-2-oxoethyl]benzamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)CNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H23F2N3O3/c1-25(14-15-2-5-17(6-3-15)26-8-10-29-11-9-26)20(27)13-24-21(28)18-7-4-16(22)12-19(18)23/h2-7,12H,8-11,13-14H2,1H3,(H,24,28) |
| InChIKey | UNFUIGLFEDQXBA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|