C19H21F2N3O2 — CID 46649991
3-(2,4-difluorophenyl)-1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]urea (PubChem CID 46649991) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]urea.
| Compound Name | 3-(2,4-difluorophenyl)-1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 46649991 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-methyl-1-[(4-morpholin-4-ylphenyl)methyl]urea |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H21F2N3O2/c1-23(19(25)22-18-7-4-15(20)12-17(18)21)13-14-2-5-16(6-3-14)24-8-10-26-11-9-24/h2-7,12H,8-11,13H2,1H3,(H,22,25) |
| InChIKey | MQIPUWITCJATKS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|