C11H10F2N2O — CID 62667575
N-(3-cyanopropyl)-2,4-difluorobenzamide (PubChem CID 62667575) has the molecular formula C11H10F2N2O and a molecular weight of 224.21 g/mol. Its IUPAC name is N-(3-cyanopropyl)-2,4-difluorobenzamide.
| Compound Name | N-(3-cyanopropyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 62667575 |
| Molecular Formula | C11H10F2N2O |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-(3-cyanopropyl)-2,4-difluorobenzamide |
| SMILES | N#CCCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H10F2N2O/c12-8-3-4-9(10(13)7-8)11(16)15-6-2-1-5-14/h3-4,7H,1-2,6H2,(H,15,16) |
| InChIKey | DMGLWDGKRSDVGA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|