C11H11F2N3O — CID 62667576
1-(3-cyanopropyl)-3-(2,4-difluorophenyl)urea (PubChem CID 62667576) has the molecular formula C11H11F2N3O and a molecular weight of 239.22 g/mol. Its IUPAC name is 1-(3-cyanopropyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(3-cyanopropyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 62667576 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-(3-cyanopropyl)-3-(2,4-difluorophenyl)urea |
| SMILES | N#CCCCNC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2N3O/c12-8-3-4-10(9(13)7-8)16-11(17)15-6-2-1-5-14/h3-4,7H,1-2,6H2,(H2,15,16,17) |
| InChIKey | VAQULQRRCRGJRO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|