C10H9F2N3O — CID 60676650
1-(2-cyanoethyl)-3-(2,4-difluorophenyl)urea (PubChem CID 60676650) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(2-cyanoethyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 60676650 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 1-(2-cyanoethyl)-3-(2,4-difluorophenyl)urea |
| SMILES | N#CCCNC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C10H9F2N3O/c11-7-2-3-9(8(12)6-7)15-10(16)14-5-1-4-13/h2-3,6H,1,5H2,(H2,14,15,16) |
| InChIKey | DHRBGZGTVOCLGL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|