C17H18F2N2O — CID 24818673
1-(2,4-difluorophenyl)-3-(4-phenylbutyl)urea (PubChem CID 24818673) has the molecular formula C17H18F2N2O and a molecular weight of 304.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(4-phenylbutyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 24818673 |
| Molecular Formula | C17H18F2N2O |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(4-phenylbutyl)urea |
| SMILES | O=C(NCCCCc1ccccc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H18F2N2O/c18-14-9-10-16(15(19)12-14)21-17(22)20-11-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,9-10,12H,4-5,8,11H2,(H2,20,21,22) |
| InChIKey | ZTDVSTGEPRPMAY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|