C22H20F2N2O2 — CID 141080201
1-(2,4-difluorophenyl)-3-[2-(4-phenylmethoxyphenyl)ethyl]urea (PubChem CID 141080201) has the molecular formula C22H20F2N2O2 and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-(4-phenylmethoxyphenyl)ethyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-(4-phenylmethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 141080201 |
| Molecular Formula | C22H20F2N2O2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-(4-phenylmethoxyphenyl)ethyl]urea |
| SMILES | O=C(NCCc1ccc(OCc2ccccc2)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C22H20F2N2O2/c23-18-8-11-21(20(24)14-18)26-22(27)25-13-12-16-6-9-19(10-7-16)28-15-17-4-2-1-3-5-17/h1-11,14H,12-13,15H2,(H2,25,26,27) |
| InChIKey | FOPSXXQHJOTZRK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |