C21H18F2N2O2 — CID 37220850
N-(2,4-difluorophenyl)-2-(4-phenylmethoxyanilino)acetamide (PubChem CID 37220850) has the molecular formula C21H18F2N2O2 and a molecular weight of 368.38 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(4-phenylmethoxyanilino)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(4-phenylmethoxyanilino)acetamide |
|---|---|
| PubChem CID | 37220850 |
| Molecular Formula | C21H18F2N2O2 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(4-phenylmethoxyanilino)acetamide |
| SMILES | O=C(CNc1ccc(OCc2ccccc2)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C21H18F2N2O2/c22-16-6-11-20(19(23)12-16)25-21(26)13-24-17-7-9-18(10-8-17)27-14-15-4-2-1-3-5-15/h1-12,24H,13-14H2,(H,25,26) |
| InChIKey | HCGCQTBYMJPHRF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|