C25H26FNO4S — CID 154859573
2-[[4-[(4-fluorophenyl)methoxy]phenyl]methylsulfonyl]-N-(2-phenylethyl)propanamide (PubChem CID 154859573) has the molecular formula C25H26FNO4S and a molecular weight of 455.55 g/mol. Its IUPAC name is 2-[[4-[(4-fluorophenyl)methoxy]phenyl]methylsulfonyl]-N-(2-phenylethyl)propanamide.
| Compound Name | 2-[[4-[(4-fluorophenyl)methoxy]phenyl]methylsulfonyl]-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 154859573 |
| Molecular Formula | C25H26FNO4S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-[[4-[(4-fluorophenyl)methoxy]phenyl]methylsulfonyl]-N-(2-phenylethyl)propanamide |
| SMILES | CC(C(=O)NCCc1ccccc1)S(=O)(=O)Cc1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H26FNO4S/c1-19(25(28)27-16-15-20-5-3-2-4-6-20)32(29,30)18-22-9-13-24(14-10-22)31-17-21-7-11-23(26)12-8-21/h2-14,19H,15-18H2,1H3,(H,27,28) |
| InChIKey | RFUNGFSBFOTXJK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |