C28H36N2O2 — CID 68977304
1-[1-(1-adamantyl)ethyl]-3-[2-(4-phenylmethoxyphenyl)ethyl]urea (PubChem CID 68977304) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 1-[1-(1-adamantyl)ethyl]-3-[2-(4-phenylmethoxyphenyl)ethyl]urea.
| Compound Name | 1-[1-(1-adamantyl)ethyl]-3-[2-(4-phenylmethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 68977304 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 1-[1-(1-adamantyl)ethyl]-3-[2-(4-phenylmethoxyphenyl)ethyl]urea |
| SMILES | CC(NC(=O)NCCc1ccc(OCc2ccccc2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H36N2O2/c1-20(28-16-23-13-24(17-28)15-25(14-23)18-28)30-27(31)29-12-11-21-7-9-26(10-8-21)32-19-22-5-3-2-4-6-22/h2-10,20,23-25H,11-19H2,1H3,(H2,29,30,31) |
| InChIKey | HIJQUAHHUSLWPD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |