C27H33NO3 — CID 59781189
3-(1-adamantyl)-2-hydroxy-N-[(4-phenylmethoxyphenyl)methyl]propanamide (PubChem CID 59781189) has the molecular formula C27H33NO3 and a molecular weight of 419.56 g/mol. Its IUPAC name is 3-(1-adamantyl)-2-hydroxy-N-[(4-phenylmethoxyphenyl)methyl]propanamide.
| Compound Name | 3-(1-adamantyl)-2-hydroxy-N-[(4-phenylmethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 59781189 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 3-(1-adamantyl)-2-hydroxy-N-[(4-phenylmethoxyphenyl)methyl]propanamide |
| SMILES | O=C(NCc1ccc(OCc2ccccc2)cc1)C(O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H33NO3/c29-25(16-27-13-21-10-22(14-27)12-23(11-21)15-27)26(30)28-17-19-6-8-24(9-7-19)31-18-20-4-2-1-3-5-20/h1-9,21-23,25,29H,10-18H2,(H,28,30) |
| InChIKey | QMFVTNYQAANQBU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |