C26H29NO3 — CID 57123573
(4S)-N-benzyl-4-hydroxy-6-(4-phenylmethoxyphenyl)hexanamide (PubChem CID 57123573) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is (4S)-N-benzyl-4-hydroxy-6-(4-phenylmethoxyphenyl)hexanamide.
| Compound Name | (4S)-N-benzyl-4-hydroxy-6-(4-phenylmethoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 57123573 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (4S)-N-benzyl-4-hydroxy-6-(4-phenylmethoxyphenyl)hexanamide |
| SMILES | O=C(CC[C@@H](O)CCc1ccc(OCc2ccccc2)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C26H29NO3/c28-24(15-18-26(29)27-19-22-7-3-1-4-8-22)14-11-21-12-16-25(17-13-21)30-20-23-9-5-2-6-10-23/h1-10,12-13,16-17,24,28H,11,14-15,18-20H2,(H,27,29)/t24-/m0/s1 |
| InChIKey | FRWXYYSIENHXPO-DEOSSOPVSA-N |
| XLogP | 4.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |