C18H20O4 — CID 11381046
3-hydroxy-5-(4-phenylmethoxyphenyl)pentanoic acid (PubChem CID 11381046) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 3-hydroxy-5-(4-phenylmethoxyphenyl)pentanoic acid.
| Compound Name | 3-hydroxy-5-(4-phenylmethoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 11381046 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-hydroxy-5-(4-phenylmethoxyphenyl)pentanoic acid |
| SMILES | O=C(O)CC(O)CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20O4/c19-16(12-18(20)21)9-6-14-7-10-17(11-8-14)22-13-15-4-2-1-3-5-15/h1-5,7-8,10-11,16,19H,6,9,12-13H2,(H,20,21) |
| InChIKey | UJUUEVBUPLACTJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |