C20H26O — CID 57147000
1-(3,4-dimethylpentyl)-4-phenylmethoxybenzene (PubChem CID 57147000) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-(3,4-dimethylpentyl)-4-phenylmethoxybenzene.
| Compound Name | 1-(3,4-dimethylpentyl)-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 57147000 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 1-(3,4-dimethylpentyl)-4-phenylmethoxybenzene |
| SMILES | CC(C)C(C)CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26O/c1-16(2)17(3)9-10-18-11-13-20(14-12-18)21-15-19-7-5-4-6-8-19/h4-8,11-14,16-17H,9-10,15H2,1-3H3 |
| InChIKey | IFAFKRCTUWVVKG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |