C15H22N4O — CID 20673419
5-[[4-(3,4-dimethylpentyl)phenoxy]methyl]-2H-tetrazole (PubChem CID 20673419) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 5-[[4-(3,4-dimethylpentyl)phenoxy]methyl]-2H-tetrazole.
| Compound Name | 5-[[4-(3,4-dimethylpentyl)phenoxy]methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 20673419 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 5-[[4-(3,4-dimethylpentyl)phenoxy]methyl]-2H-tetrazole |
| SMILES | CC(C)C(C)CCc1ccc(OCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C15H22N4O/c1-11(2)12(3)4-5-13-6-8-14(9-7-13)20-10-15-16-18-19-17-15/h6-9,11-12H,4-5,10H2,1-3H3,(H,16,17,18,19) |
| InChIKey | TULGEVXXWVXHTF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |