C19H19F2N5O2 — CID 140707692
N-[[4-(1,1-difluoroethyl)phenyl]methoxy]-1-[4-(2H-tetrazol-5-ylmethoxy)phenyl]ethanimine (PubChem CID 140707692) has the molecular formula C19H19F2N5O2 and a molecular weight of 387.39 g/mol. Its IUPAC name is N-[[4-(1,1-difluoroethyl)phenyl]methoxy]-1-[4-(2H-tetrazol-5-ylmethoxy)phenyl]ethanimine.
| Compound Name | N-[[4-(1,1-difluoroethyl)phenyl]methoxy]-1-[4-(2H-tetrazol-5-ylmethoxy)phenyl]ethanimine |
|---|---|
| PubChem CID | 140707692 |
| Molecular Formula | C19H19F2N5O2 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-[[4-(1,1-difluoroethyl)phenyl]methoxy]-1-[4-(2H-tetrazol-5-ylmethoxy)phenyl]ethanimine |
| SMILES | CC(=NOCc1ccc(C(C)(F)F)cc1)c1ccc(OCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C19H19F2N5O2/c1-13(24-28-11-14-3-7-16(8-4-14)19(2,20)21)15-5-9-17(10-6-15)27-12-18-22-25-26-23-18/h3-10H,11-12H2,1-2H3,(H,22,23,25,26) |
| InChIKey | JGIAZIQNXTVQHQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|