C17H14ClF3N6O2 — CID 118954185
1-[2-chloro-6-(2H-tetrazol-5-ylmethoxy)-3-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine (PubChem CID 118954185) has the molecular formula C17H14ClF3N6O2 and a molecular weight of 426.79 g/mol. Its IUPAC name is 1-[2-chloro-6-(2H-tetrazol-5-ylmethoxy)-3-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine.
| Compound Name | 1-[2-chloro-6-(2H-tetrazol-5-ylmethoxy)-3-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 118954185 |
| Molecular Formula | C17H14ClF3N6O2 |
| Molecular Weight | 426.79 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 1-[2-chloro-6-(2H-tetrazol-5-ylmethoxy)-3-pyridinyl]-N-[[4-(trifluoromethyl)phenyl]methoxy]ethanimine |
| SMILES | CC(=NOCc1ccc(C(F)(F)F)cc1)c1ccc(OCc2nn[nH]n2)nc1Cl |
| InChI | InChI=1S/C17H14ClF3N6O2/c1-10(25-29-8-11-2-4-12(5-3-11)17(19,20)21)13-6-7-15(22-16(13)18)28-9-14-23-26-27-24-14/h2-7H,8-9H2,1H3,(H,23,24,26,27) |
| InChIKey | IFEJPNKJDLJLMI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|