C18H16F6N2O3S — CID 123691657
CID 123691657 (PubChem CID 123691657) has the molecular formula C18H16F6N2O3S and a molecular weight of 454.39 g/mol.
| Compound Name | CID 123691657 |
|---|---|
| PubChem CID | 123691657 |
| Molecular Formula | C18H16F6N2O3S |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | — |
| SMILES | C/C(=N/OCc1ccc(C(F)(F)F)cc1)c1ccc(C)cc1C(F)(F)F.N=S(=O)=O |
| InChI | InChI=1S/C18H15F6NO.HNO2S/c1-11-3-8-15(16(9-11)18(22,23)24)12(2)25-26-10-13-4-6-14(7-5-13)17(19,20)21;1-4(2)3/h3-9H,10H2,1-2H3;1H/b25-12-; |
| InChIKey | HTHHWAPSHLPXBV-IPVYGFMGSA-N |
| XLogP | 5.60 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|