C20H21F3N2O4 — CID 139659808
methyl N-(methoxymethyl)-N-[2-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]carbamate (PubChem CID 139659808) has the molecular formula C20H21F3N2O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is methyl N-(methoxymethyl)-N-[2-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]carbamate.
| Compound Name | methyl N-(methoxymethyl)-N-[2-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 139659808 |
| Molecular Formula | C20H21F3N2O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | methyl N-(methoxymethyl)-N-[2-[(E)-C-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]carbamate |
| SMILES | COCN(C(=O)OC)c1ccccc1/C(C)=N/OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N2O4/c1-14(24-29-12-15-8-10-16(11-9-15)20(21,22)23)17-6-4-5-7-18(17)25(13-27-2)19(26)28-3/h4-11H,12-13H2,1-3H3/b24-14+ |
| InChIKey | ZGXSTXSCWRKWCA-ZVHZXABRSA-N |
| XLogP | 4.82 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|