C22H22F3N3O5 — CID 11134406
(2E)-N-(2-methoxyacetyl)-2-methoxyimino-2-[2-[[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetamide (PubChem CID 11134406) has the molecular formula C22H22F3N3O5 and a molecular weight of 465.43 g/mol. Its IUPAC name is (2E)-N-(2-methoxyacetyl)-2-methoxyimino-2-[2-[[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetamide.
| Compound Name | (2E)-N-(2-methoxyacetyl)-2-methoxyimino-2-[2-[[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 11134406 |
| Molecular Formula | C22H22F3N3O5 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (2E)-N-(2-methoxyacetyl)-2-methoxyimino-2-[2-[[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetamide |
| SMILES | COCC(=O)NC(=O)/C(=N/OC)c1ccccc1CO/N=C(\C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F3N3O5/c1-14(15-8-10-17(11-9-15)22(23,24)25)27-33-12-16-6-4-5-7-18(16)20(28-32-3)21(30)26-19(29)13-31-2/h4-11H,12-13H2,1-3H3,(H,26,29,30)/b27-14+,28-20+ |
| InChIKey | XRADLJDZBAVUMA-VSICBDRASA-N |
| XLogP | 3.29 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|