C21H19ClF3N3O4 — CID 173274904
N-(2-chloroacetyl)-2-[2-[(ethylideneamino)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methoxyiminoacetamide (PubChem CID 173274904) has the molecular formula C21H19ClF3N3O4 and a molecular weight of 469.85 g/mol. Its IUPAC name is N-(2-chloroacetyl)-2-[2-[(ethylideneamino)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methoxyiminoacetamide.
| Compound Name | N-(2-chloroacetyl)-2-[2-[(ethylideneamino)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 173274904 |
| Molecular Formula | C21H19ClF3N3O4 |
| Molecular Weight | 469.85 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-(2-chloroacetyl)-2-[2-[(ethylideneamino)-hydroxy-[4-(trifluoromethyl)phenyl]methyl]phenyl]-2-methoxyiminoacetamide |
| SMILES | CC=NC(O)(c1ccc(C(F)(F)F)cc1)c1ccccc1C(=NOC)C(=O)NC(=O)CCl |
| InChI | InChI=1S/C21H19ClF3N3O4/c1-3-26-20(31,13-8-10-14(11-9-13)21(23,24)25)16-7-5-4-6-15(16)18(28-32-2)19(30)27-17(29)12-22/h3-11,31H,12H2,1-2H3,(H,27,29,30) |
| InChIKey | BHWBMLNXWXDHOW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.85 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|