C16H14F3N3O3 — CID 15767096
(2Z)-2-methoxyimino-N-methyl-2-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]acetamide (PubChem CID 15767096) has the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. Its IUPAC name is (2Z)-2-methoxyimino-N-methyl-2-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]acetamide.
| Compound Name | (2Z)-2-methoxyimino-N-methyl-2-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]acetamide |
|---|---|
| PubChem CID | 15767096 |
| Molecular Formula | C16H14F3N3O3 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (2Z)-2-methoxyimino-N-methyl-2-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]acetamide |
| SMILES | CNC(=O)/C(=N\OC)c1ccccc1Oc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H14F3N3O3/c1-20-15(23)14(22-24-2)11-5-3-4-6-12(11)25-13-8-7-10(9-21-13)16(17,18)19/h3-9H,1-2H3,(H,20,23)/b22-14- |
| InChIKey | JMQQBEAVXYIZIO-HMAPJEAMSA-N |
| XLogP | 2.99 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|