C22H20N2O4 — CID 54359900
2-methoxyimino-N-methyl-2-[2-(4-phenoxyphenoxy)phenyl]acetamide (PubChem CID 54359900) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-methoxyimino-N-methyl-2-[2-(4-phenoxyphenoxy)phenyl]acetamide.
| Compound Name | 2-methoxyimino-N-methyl-2-[2-(4-phenoxyphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54359900 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-methoxyimino-N-methyl-2-[2-(4-phenoxyphenoxy)phenyl]acetamide |
| SMILES | CNC(=O)C(=NOC)c1ccccc1Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-23-22(25)21(24-26-2)19-10-6-7-11-20(19)28-18-14-12-17(13-15-18)27-16-8-4-3-5-9-16/h3-15H,1-2H3,(H,23,25) |
| InChIKey | ULUBDDVHAIRNTA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|