C10H12N2O2 — CID 18413242
(2E)-2-methoxyimino-N-methyl-2-phenylacetamide (PubChem CID 18413242) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (2E)-2-methoxyimino-N-methyl-2-phenylacetamide.
| Compound Name | (2E)-2-methoxyimino-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 18413242 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (2E)-2-methoxyimino-N-methyl-2-phenylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1ccccc1 |
| InChI | InChI=1S/C10H12N2O2/c1-11-10(13)9(12-14-2)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,11,13)/b12-9+ |
| InChIKey | ZNSVBJMHMOZEJZ-FMIVXFBMSA-N |
| XLogP | 0.78 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|